C33H34N2 — CID 69331380
1,2,3,6-tetramethyl-7-[2-(1,2,3,6-tetramethylcyclopenta[b]indol-7-yl)propan-2-yl]cyclopenta[b]indole (PubChem CID 69331380) has the molecular formula C33H34N2 and a molecular weight of 458.65 g/mol. Its IUPAC name is 1,2,3,6-tetramethyl-7-[2-(1,2,3,6-tetramethylcyclopenta[b]indol-7-yl)propan-2-yl]cyclopenta[b]indole.
| Compound Name | 1,2,3,6-tetramethyl-7-[2-(1,2,3,6-tetramethylcyclopenta[b]indol-7-yl)propan-2-yl]cyclopenta[b]indole |
|---|---|
| PubChem CID | 69331380 |
| Molecular Formula | C33H34N2 |
| Molecular Weight | 458.65 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | 1,2,3,6-tetramethyl-7-[2-(1,2,3,6-tetramethylcyclopenta[b]indol-7-yl)propan-2-yl]cyclopenta[b]indole |
| SMILES | CC1=C(C)C(C)=C2C1=Nc1cc(C)c(C(C)(C)c3cc4c(cc3C)N=C3C(C)=C(C)C(C)=C34)cc12 |
| InChI | InChI=1S/C33H34N2/c1-15-11-27-23(29-19(5)17(3)21(7)31(29)34-27)13-25(15)33(9,10)26-14-24-28(12-16(26)2)35-32-22(8)18(4)20(6)30(24)32/h11-14H,1-10H3 |
| InChIKey | JCFNLYWUOUULGQ-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.65 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |