C35H32N10O2S4 — CID 69331709
5,5-bis[2-[[4-(2-phenylsulfanyl-1,3-thiazol-5-yl)pyrimidin-2-yl]amino]propyl]imidazolidine-2,4-dione (PubChem CID 69331709) has the molecular formula C35H32N10O2S4 and a molecular weight of 752.98 g/mol. Its IUPAC name is 5,5-bis[2-[[4-(2-phenylsulfanyl-1,3-thiazol-5-yl)pyrimidin-2-yl]amino]propyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-bis[2-[[4-(2-phenylsulfanyl-1,3-thiazol-5-yl)pyrimidin-2-yl]amino]propyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 69331709 |
| Molecular Formula | C35H32N10O2S4 |
| Molecular Weight | 752.98 g/mol |
| Exact Mass | 752.16 |
| IUPAC Name | 5,5-bis[2-[[4-(2-phenylsulfanyl-1,3-thiazol-5-yl)pyrimidin-2-yl]amino]propyl]imidazolidine-2,4-dione |
| SMILES | CC(CC1(CC(C)Nc2nccc(-c3cnc(Sc4ccccc4)s3)n2)NC(=O)NC1=O)Nc1nccc(-c2cnc(Sc3ccccc3)s2)n1 |
| InChI | InChI=1S/C35H32N10O2S4/c1-21(40-30-36-15-13-25(42-30)27-19-38-33(50-27)48-23-9-5-3-6-10-23)17-35(29(46)44-32(47)45-35)18-22(2)41-31-37-16-14-26(43-31)28-20-39-34(51-28)49-24-11-7-4-8-12-24/h3-16,19-22H,17-18H2,1-2H3,(H,36,40,42)(H,37,41,43)(H2,44,45,46,47) |
| InChIKey | IUCWBKKAQYUJFP-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 159.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.98 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|