C10H8Cl4N2 — CID 6933181
(5R)-3-(4-chlorophenyl)-5-(trichloromethyl)-4,5-dihydro-1H-pyrazole (PubChem CID 6933181) has the molecular formula C10H8Cl4N2 and a molecular weight of 298.00 g/mol. Its IUPAC name is (5R)-3-(4-chlorophenyl)-5-(trichloromethyl)-4,5-dihydro-1H-pyrazole.
| Compound Name | (5R)-3-(4-chlorophenyl)-5-(trichloromethyl)-4,5-dihydro-1H-pyrazole |
|---|---|
| PubChem CID | 6933181 |
| Molecular Formula | C10H8Cl4N2 |
| Molecular Weight | 298.00 g/mol |
| Exact Mass | 295.94 |
| IUPAC Name | (5R)-3-(4-chlorophenyl)-5-(trichloromethyl)-4,5-dihydro-1H-pyrazole |
| SMILES | Clc1ccc(C2=NN[C@@H](C(Cl)(Cl)Cl)C2)cc1 |
| InChI | InChI=1S/C10H8Cl4N2/c11-7-3-1-6(2-4-7)8-5-9(16-15-8)10(12,13)14/h1-4,9,16H,5H2/t9-/m1/s1 |
| InChIKey | OVIJHSVAAISBQV-SECBINFHSA-N |
| XLogP | 3.78 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.00 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|