About 1-(2-aminoethyl)-4,4-dimethylimidazolidin-2-one
1-(2-aminoethyl)-4,4-dimethylimidazolidin-2-one (PubChem CID 69331813) has the molecular formula C7H15N3O
and a molecular weight of 157.22 g/mol. Its IUPAC name is 1-(2-aminoethyl)-4,4-dimethylimidazolidin-2-one.
Molecular Properties
| Compound Name | 1-(2-aminoethyl)-4,4-dimethylimidazolidin-2-one |
| PubChem CID | 69331813 |
| Molecular Formula | C7H15N3O |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.12 |
| IUPAC Name | 1-(2-aminoethyl)-4,4-dimethylimidazolidin-2-one |
| SMILES | CC1(C)CN(CCN)C(=O)N1 |
| InChI | InChI=1S/C7H15N3O/c1-7(2)5-10(4-3-8)6(11)9-7/h3-5,8H2,1-2H3,(H,9,11) |
| InChIKey | ZASKTCAARYNBLT-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2-aminoethyl)-4,4-dimethylimidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-aminoethyl)-4,4-dimethylimidazolidin-2-one?
The IUPAC name of 1-(2-aminoethyl)-4,4-dimethylimidazolidin-2-one (CID 69331813) is 1-(2-aminoethyl)-4,4-dimethylimidazolidin-2-one.
What is the SMILES notation for 1-(2-aminoethyl)-4,4-dimethylimidazolidin-2-one?
The canonical SMILES for 1-(2-aminoethyl)-4,4-dimethylimidazolidin-2-one is CC1(C)CN(CCN)C(=O)N1.
What is the InChIKey of 1-(2-aminoethyl)-4,4-dimethylimidazolidin-2-one?
The InChIKey is ZASKTCAARYNBLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N3O/c1-7(2)5-10(4-3-8)6(11)9-7/h3-5,8H2,1-2H3,(H,9,11).
What are the key properties of 1-(2-aminoethyl)-4,4-dimethylimidazolidin-2-one?
1-(2-aminoethyl)-4,4-dimethylimidazolidin-2-one has a molecular weight of 157.22 g/mol, XLogP of -0.25, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-aminoethyl)-4,4-dimethylimidazolidin-2-one is sourced from PubChem (CID 69331813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).