About CID 69332410
CID 69332410 (PubChem CID 69332410) has the molecular formula C26H36NO4Si
and a molecular weight of 454.66 g/mol.
Molecular Properties
| Compound Name | CID 69332410 |
| PubChem CID | 69332410 |
| Molecular Formula | C26H36NO4Si |
| Molecular Weight | 454.66 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](O)C[C@@]1(CO[Si](c1ccccc1)c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H36NO4Si/c1-24(2,3)26(17-20(28)18-27(26)23(29)31-25(4,5)6)19-30-32(21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-16,20,28H,17-19H2,1-6H3/t20-,26-/m1/s1 |
| InChIKey | BHAKTDRXIAXFDO-FQRUVTKNSA-N |
| XLogP | 3.60 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.66 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 69332410 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 69332410?
The IUPAC name of CID 69332410 (CID 69332410) is not available.
What is the SMILES notation for CID 69332410?
The canonical SMILES for CID 69332410 is CC(C)(C)OC(=O)N1C[C@H](O)C[C@@]1(CO[Si](c1ccccc1)c1ccccc1)C(C)(C)C.
What is the InChIKey of CID 69332410?
The InChIKey is BHAKTDRXIAXFDO-FQRUVTKNSA-N. The full InChI is InChI=1S/C26H36NO4Si/c1-24(2,3)26(17-20(28)18-27(26)23(29)31-25(4,5)6)19-30-32(21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-16,20,28H,17-19H2,1-6H3/t20-,26-/m1/s1.
What are the key properties of CID 69332410?
CID 69332410 has a molecular weight of 454.66 g/mol, XLogP of 3.60, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 69332410 is sourced from PubChem (CID 69332410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).