About 5-(trifluoromethyl)-1H-imidazole-2,4-diamine
5-(trifluoromethyl)-1H-imidazole-2,4-diamine (PubChem CID 69332688) has the molecular formula C4H5F3N4
and a molecular weight of 166.11 g/mol. Its IUPAC name is 5-(trifluoromethyl)-1H-imidazole-2,4-diamine.
Molecular Properties
| Compound Name | 5-(trifluoromethyl)-1H-imidazole-2,4-diamine |
| PubChem CID | 69332688 |
| Molecular Formula | C4H5F3N4 |
| Molecular Weight | 166.11 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | 5-(trifluoromethyl)-1H-imidazole-2,4-diamine |
| SMILES | Nc1nc(N)c(C(F)(F)F)[nH]1 |
| InChI | InChI=1S/C4H5F3N4/c5-4(6,7)1-2(8)11-3(9)10-1/h8H2,(H3,9,10,11) |
| InChIKey | UZRJTCKYWMNOAK-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 80.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.11 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(trifluoromethyl)-1H-imidazole-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(trifluoromethyl)-1H-imidazole-2,4-diamine?
The IUPAC name of 5-(trifluoromethyl)-1H-imidazole-2,4-diamine (CID 69332688) is 5-(trifluoromethyl)-1H-imidazole-2,4-diamine.
What is the SMILES notation for 5-(trifluoromethyl)-1H-imidazole-2,4-diamine?
The canonical SMILES for 5-(trifluoromethyl)-1H-imidazole-2,4-diamine is Nc1nc(N)c(C(F)(F)F)[nH]1.
What is the InChIKey of 5-(trifluoromethyl)-1H-imidazole-2,4-diamine?
The InChIKey is UZRJTCKYWMNOAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5F3N4/c5-4(6,7)1-2(8)11-3(9)10-1/h8H2,(H3,9,10,11).
What are the key properties of 5-(trifluoromethyl)-1H-imidazole-2,4-diamine?
5-(trifluoromethyl)-1H-imidazole-2,4-diamine has a molecular weight of 166.11 g/mol, XLogP of 0.59, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(trifluoromethyl)-1H-imidazole-2,4-diamine is sourced from PubChem (CID 69332688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).