About 4-[[4-fluoro-3-(1,3-oxazol-2-ylcarbamoylamino)phenyl]methyl]-2-methylpiperazine-1-carboxylic acid
4-[[4-fluoro-3-(1,3-oxazol-2-ylcarbamoylamino)phenyl]methyl]-2-methylpiperazine-1-carboxylic acid (PubChem CID 69333349) has the molecular formula C17H20FN5O4
and a molecular weight of 377.38 g/mol. Its IUPAC name is 4-[[4-fluoro-3-(1,3-oxazol-2-ylcarbamoylamino)phenyl]methyl]-2-methylpiperazine-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-[[4-fluoro-3-(1,3-oxazol-2-ylcarbamoylamino)phenyl]methyl]-2-methylpiperazine-1-carboxylic acid |
| PubChem CID | 69333349 |
| Molecular Formula | C17H20FN5O4 |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 4-[[4-fluoro-3-(1,3-oxazol-2-ylcarbamoylamino)phenyl]methyl]-2-methylpiperazine-1-carboxylic acid |
| SMILES | CC1CN(Cc2ccc(F)c(NC(=O)Nc3ncco3)c2)CCN1C(=O)O |
| InChI | InChI=1S/C17H20FN5O4/c1-11-9-22(5-6-23(11)17(25)26)10-12-2-3-13(18)14(8-12)20-15(24)21-16-19-4-7-27-16/h2-4,7-8,11H,5-6,9-10H2,1H3,(H,25,26)(H2,19,20,21,24) |
| InChIKey | UMDNBRNKWRHRIQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 110.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[4-fluoro-3-(1,3-oxazol-2-ylcarbamoylamino)phenyl]methyl]-2-methylpiperazine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-fluoro-3-(1,3-oxazol-2-ylcarbamoylamino)phenyl]methyl]-2-methylpiperazine-1-carboxylic acid?
The IUPAC name of 4-[[4-fluoro-3-(1,3-oxazol-2-ylcarbamoylamino)phenyl]methyl]-2-methylpiperazine-1-carboxylic acid (CID 69333349) is 4-[[4-fluoro-3-(1,3-oxazol-2-ylcarbamoylamino)phenyl]methyl]-2-methylpiperazine-1-carboxylic acid.
What is the SMILES notation for 4-[[4-fluoro-3-(1,3-oxazol-2-ylcarbamoylamino)phenyl]methyl]-2-methylpiperazine-1-carboxylic acid?
The canonical SMILES for 4-[[4-fluoro-3-(1,3-oxazol-2-ylcarbamoylamino)phenyl]methyl]-2-methylpiperazine-1-carboxylic acid is CC1CN(Cc2ccc(F)c(NC(=O)Nc3ncco3)c2)CCN1C(=O)O.
What is the InChIKey of 4-[[4-fluoro-3-(1,3-oxazol-2-ylcarbamoylamino)phenyl]methyl]-2-methylpiperazine-1-carboxylic acid?
The InChIKey is UMDNBRNKWRHRIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20FN5O4/c1-11-9-22(5-6-23(11)17(25)26)10-12-2-3-13(18)14(8-12)20-15(24)21-16-19-4-7-27-16/h2-4,7-8,11H,5-6,9-10H2,1H3,(H,25,26)(H2,19,20,21,24).
What are the key properties of 4-[[4-fluoro-3-(1,3-oxazol-2-ylcarbamoylamino)phenyl]methyl]-2-methylpiperazine-1-carboxylic acid?
4-[[4-fluoro-3-(1,3-oxazol-2-ylcarbamoylamino)phenyl]methyl]-2-methylpiperazine-1-carboxylic acid has a molecular weight of 377.38 g/mol, XLogP of 2.64, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-fluoro-3-(1,3-oxazol-2-ylcarbamoylamino)phenyl]methyl]-2-methylpiperazine-1-carboxylic acid is sourced from PubChem (CID 69333349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).