C36H36N4O9 — CID 69333477
4-[[1-[2-[3-methoxy-4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]-4-phenylmethoxypyrrolidin-2-yl]methoxy]-3-nitrobenzoic acid (PubChem CID 69333477) has the molecular formula C36H36N4O9 and a molecular weight of 668.70 g/mol. Its IUPAC name is 4-[[1-[2-[3-methoxy-4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]-4-phenylmethoxypyrrolidin-2-yl]methoxy]-3-nitrobenzoic acid.
| Compound Name | 4-[[1-[2-[3-methoxy-4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]-4-phenylmethoxypyrrolidin-2-yl]methoxy]-3-nitrobenzoic acid |
|---|---|
| PubChem CID | 69333477 |
| Molecular Formula | C36H36N4O9 |
| Molecular Weight | 668.70 g/mol |
| Exact Mass | 668.25 |
| IUPAC Name | 4-[[1-[2-[3-methoxy-4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]-4-phenylmethoxypyrrolidin-2-yl]methoxy]-3-nitrobenzoic acid |
| SMILES | COc1cc(CC(=O)N2CC(OCc3ccccc3)CC2COc2ccc(C(=O)O)cc2[N+](=O)[O-])ccc1NC(=O)Nc1ccccc1C |
| InChI | InChI=1S/C36H36N4O9/c1-23-8-6-7-11-29(23)37-36(44)38-30-14-12-25(16-33(30)47-2)17-34(41)39-20-28(48-21-24-9-4-3-5-10-24)19-27(39)22-49-32-15-13-26(35(42)43)18-31(32)40(45)46/h3-16,18,27-28H,17,19-22H2,1-2H3,(H,42,43)(H2,37,38,44) |
| InChIKey | RBFHZTRBEYLGQA-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 169.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.70 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|