About 5-amino-4-methyl-3H-1,3-thiazol-2-one
5-amino-4-methyl-3H-1,3-thiazol-2-one (PubChem CID 69333539) has the molecular formula C4H6N2OS
and a molecular weight of 130.17 g/mol. Its IUPAC name is 5-amino-4-methyl-3H-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 5-amino-4-methyl-3H-1,3-thiazol-2-one |
| PubChem CID | 69333539 |
| Molecular Formula | C4H6N2OS |
| Molecular Weight | 130.17 g/mol |
| Exact Mass | 130.02 |
| IUPAC Name | 5-amino-4-methyl-3H-1,3-thiazol-2-one |
| SMILES | Cc1[nH]c(=O)sc1N |
| InChI | InChI=1S/C4H6N2OS/c1-2-3(5)8-4(7)6-2/h5H2,1H3,(H,6,7) |
| InChIKey | HMOSKMODKYBVIV-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.17 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-amino-4-methyl-3H-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-4-methyl-3H-1,3-thiazol-2-one?
The IUPAC name of 5-amino-4-methyl-3H-1,3-thiazol-2-one (CID 69333539) is 5-amino-4-methyl-3H-1,3-thiazol-2-one.
What is the SMILES notation for 5-amino-4-methyl-3H-1,3-thiazol-2-one?
The canonical SMILES for 5-amino-4-methyl-3H-1,3-thiazol-2-one is Cc1[nH]c(=O)sc1N.
What is the InChIKey of 5-amino-4-methyl-3H-1,3-thiazol-2-one?
The InChIKey is HMOSKMODKYBVIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2OS/c1-2-3(5)8-4(7)6-2/h5H2,1H3,(H,6,7).
What are the key properties of 5-amino-4-methyl-3H-1,3-thiazol-2-one?
5-amino-4-methyl-3H-1,3-thiazol-2-one has a molecular weight of 130.17 g/mol, XLogP of 0.33, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-4-methyl-3H-1,3-thiazol-2-one is sourced from PubChem (CID 69333539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).