C25H29FO — CID 69333799
3-[2-(4-fluorophenyl)propan-2-yl]-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromene (PubChem CID 69333799) has the molecular formula C25H29FO and a molecular weight of 364.50 g/mol. Its IUPAC name is 3-[2-(4-fluorophenyl)propan-2-yl]-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromene.
| Compound Name | 3-[2-(4-fluorophenyl)propan-2-yl]-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromene |
|---|---|
| PubChem CID | 69333799 |
| Molecular Formula | C25H29FO |
| Molecular Weight | 364.50 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 3-[2-(4-fluorophenyl)propan-2-yl]-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromene |
| SMILES | CC1=CCC2C(C1)c1ccc(C(C)(C)c3ccc(F)cc3)cc1OC2(C)C |
| InChI | InChI=1S/C25H29FO/c1-16-6-13-22-21(14-16)20-12-9-18(15-23(20)27-25(22,4)5)24(2,3)17-7-10-19(26)11-8-17/h6-12,15,21-22H,13-14H2,1-5H3 |
| InChIKey | QJSXOQLEQVSIOL-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.50 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|