About 5-methoxyfuran-3-amine
5-methoxyfuran-3-amine (PubChem CID 69333956) has the molecular formula C5H7NO2
and a molecular weight of 113.12 g/mol. Its IUPAC name is 5-methoxyfuran-3-amine.
Molecular Properties
| Compound Name | 5-methoxyfuran-3-amine |
| PubChem CID | 69333956 |
| Molecular Formula | C5H7NO2 |
| Molecular Weight | 113.12 g/mol |
| Exact Mass | 113.05 |
| IUPAC Name | 5-methoxyfuran-3-amine |
| SMILES | COc1cc(N)co1 |
| InChI | InChI=1S/C5H7NO2/c1-7-5-2-4(6)3-8-5/h2-3H,6H2,1H3 |
| InChIKey | UUPUDGCEZBPGHU-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.12 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methoxyfuran-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxyfuran-3-amine?
The IUPAC name of 5-methoxyfuran-3-amine (CID 69333956) is 5-methoxyfuran-3-amine.
What is the SMILES notation for 5-methoxyfuran-3-amine?
The canonical SMILES for 5-methoxyfuran-3-amine is COc1cc(N)co1.
What is the InChIKey of 5-methoxyfuran-3-amine?
The InChIKey is UUPUDGCEZBPGHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO2/c1-7-5-2-4(6)3-8-5/h2-3H,6H2,1H3.
What are the key properties of 5-methoxyfuran-3-amine?
5-methoxyfuran-3-amine has a molecular weight of 113.12 g/mol, XLogP of 0.87, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxyfuran-3-amine is sourced from PubChem (CID 69333956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).