C10H15N3O5 — CID 69333966
3-[(6-methoxy-3-nitro-2-pyridinyl)-methylamino]propane-1,2-diol (PubChem CID 69333966) has the molecular formula C10H15N3O5 and a molecular weight of 257.25 g/mol. Its IUPAC name is 3-[(6-methoxy-3-nitro-2-pyridinyl)-methylamino]propane-1,2-diol.
| Compound Name | 3-[(6-methoxy-3-nitro-2-pyridinyl)-methylamino]propane-1,2-diol |
|---|---|
| PubChem CID | 69333966 |
| Molecular Formula | C10H15N3O5 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 3-[(6-methoxy-3-nitro-2-pyridinyl)-methylamino]propane-1,2-diol |
| SMILES | COc1ccc([N+](=O)[O-])c(N(C)CC(O)CO)n1 |
| InChI | InChI=1S/C10H15N3O5/c1-12(5-7(15)6-14)10-8(13(16)17)3-4-9(11-10)18-2/h3-4,7,14-15H,5-6H2,1-2H3 |
| InChIKey | ITOIBCKCGGRDGA-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 108.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|