About furan-2,4-diol
furan-2,4-diol (PubChem CID 69334491) has the molecular formula C4H4O3
and a molecular weight of 100.07 g/mol. Its IUPAC name is furan-2,4-diol.
Molecular Properties
| Compound Name | furan-2,4-diol |
| PubChem CID | 69334491 |
| Molecular Formula | C4H4O3 |
| Molecular Weight | 100.07 g/mol |
| Exact Mass | 100.02 |
| IUPAC Name | furan-2,4-diol |
| SMILES | Oc1coc(O)c1 |
| InChI | InChI=1S/C4H4O3/c5-3-1-4(6)7-2-3/h1-2,5-6H |
| InChIKey | ATVQROYXCXDQIB-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.07 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze furan-2,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-2,4-diol?
The IUPAC name of furan-2,4-diol (CID 69334491) is furan-2,4-diol.
What is the SMILES notation for furan-2,4-diol?
The canonical SMILES for furan-2,4-diol is Oc1coc(O)c1.
What is the InChIKey of furan-2,4-diol?
The InChIKey is ATVQROYXCXDQIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4O3/c5-3-1-4(6)7-2-3/h1-2,5-6H.
What are the key properties of furan-2,4-diol?
furan-2,4-diol has a molecular weight of 100.07 g/mol, XLogP of 0.69, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for furan-2,4-diol is sourced from PubChem (CID 69334491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).