About 5-(1,3-thiazol-2-yl)-1H-imidazole-2,4-diamine
5-(1,3-thiazol-2-yl)-1H-imidazole-2,4-diamine (PubChem CID 69334775) has the molecular formula C6H7N5S
and a molecular weight of 181.22 g/mol. Its IUPAC name is 5-(1,3-thiazol-2-yl)-1H-imidazole-2,4-diamine.
Molecular Properties
| Compound Name | 5-(1,3-thiazol-2-yl)-1H-imidazole-2,4-diamine |
| PubChem CID | 69334775 |
| Molecular Formula | C6H7N5S |
| Molecular Weight | 181.22 g/mol |
| Exact Mass | 181.04 |
| IUPAC Name | 5-(1,3-thiazol-2-yl)-1H-imidazole-2,4-diamine |
| SMILES | Nc1nc(N)c(-c2nccs2)[nH]1 |
| InChI | InChI=1S/C6H7N5S/c7-4-3(10-6(8)11-4)5-9-1-2-12-5/h1-2H,7H2,(H3,8,10,11) |
| InChIKey | AJGHRBPBTQTVEO-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.22 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(1,3-thiazol-2-yl)-1H-imidazole-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,3-thiazol-2-yl)-1H-imidazole-2,4-diamine?
The IUPAC name of 5-(1,3-thiazol-2-yl)-1H-imidazole-2,4-diamine (CID 69334775) is 5-(1,3-thiazol-2-yl)-1H-imidazole-2,4-diamine.
What is the SMILES notation for 5-(1,3-thiazol-2-yl)-1H-imidazole-2,4-diamine?
The canonical SMILES for 5-(1,3-thiazol-2-yl)-1H-imidazole-2,4-diamine is Nc1nc(N)c(-c2nccs2)[nH]1.
What is the InChIKey of 5-(1,3-thiazol-2-yl)-1H-imidazole-2,4-diamine?
The InChIKey is AJGHRBPBTQTVEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N5S/c7-4-3(10-6(8)11-4)5-9-1-2-12-5/h1-2H,7H2,(H3,8,10,11).
What are the key properties of 5-(1,3-thiazol-2-yl)-1H-imidazole-2,4-diamine?
5-(1,3-thiazol-2-yl)-1H-imidazole-2,4-diamine has a molecular weight of 181.22 g/mol, XLogP of 0.70, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3-thiazol-2-yl)-1H-imidazole-2,4-diamine is sourced from PubChem (CID 69334775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).