C7H13N3OS — CID 69335060
2-[(5-amino-1,3-thiazol-2-yl)-ethylamino]ethanol (PubChem CID 69335060) has the molecular formula C7H13N3OS and a molecular weight of 187.27 g/mol. Its IUPAC name is 2-[(5-amino-1,3-thiazol-2-yl)-ethylamino]ethanol.
| Compound Name | 2-[(5-amino-1,3-thiazol-2-yl)-ethylamino]ethanol |
|---|---|
| PubChem CID | 69335060 |
| Molecular Formula | C7H13N3OS |
| Molecular Weight | 187.27 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 2-[(5-amino-1,3-thiazol-2-yl)-ethylamino]ethanol |
| SMILES | CCN(CCO)c1ncc(N)s1 |
| InChI | InChI=1S/C7H13N3OS/c1-2-10(3-4-11)7-9-5-6(8)12-7/h5,11H,2-4,8H2,1H3 |
| InChIKey | AFSRXYQVUBCZOI-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 62.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.27 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |