About 2,5-diamino-1,3-oxazole-4-carbonitrile
2,5-diamino-1,3-oxazole-4-carbonitrile (PubChem CID 69335213) has the molecular formula C4H4N4O
and a molecular weight of 124.10 g/mol. Its IUPAC name is 2,5-diamino-1,3-oxazole-4-carbonitrile.
Molecular Properties
| Compound Name | 2,5-diamino-1,3-oxazole-4-carbonitrile |
| PubChem CID | 69335213 |
| Molecular Formula | C4H4N4O |
| Molecular Weight | 124.10 g/mol |
| Exact Mass | 124.04 |
| IUPAC Name | 2,5-diamino-1,3-oxazole-4-carbonitrile |
| SMILES | N#Cc1nc(N)oc1N |
| InChI | InChI=1S/C4H4N4O/c5-1-2-3(6)9-4(7)8-2/h6H2,(H2,7,8) |
| InChIKey | SABIFULWQYJXNB-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 101.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.10 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,5-diamino-1,3-oxazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-diamino-1,3-oxazole-4-carbonitrile?
The IUPAC name of 2,5-diamino-1,3-oxazole-4-carbonitrile (CID 69335213) is 2,5-diamino-1,3-oxazole-4-carbonitrile.
What is the SMILES notation for 2,5-diamino-1,3-oxazole-4-carbonitrile?
The canonical SMILES for 2,5-diamino-1,3-oxazole-4-carbonitrile is N#Cc1nc(N)oc1N.
What is the InChIKey of 2,5-diamino-1,3-oxazole-4-carbonitrile?
The InChIKey is SABIFULWQYJXNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N4O/c5-1-2-3(6)9-4(7)8-2/h6H2,(H2,7,8).
What are the key properties of 2,5-diamino-1,3-oxazole-4-carbonitrile?
2,5-diamino-1,3-oxazole-4-carbonitrile has a molecular weight of 124.10 g/mol, XLogP of -0.29, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-diamino-1,3-oxazole-4-carbonitrile is sourced from PubChem (CID 69335213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).