About 2-ethylhexyl 3-(1H-imidazol-5-yl)-3-oxopropanoate
2-ethylhexyl 3-(1H-imidazol-5-yl)-3-oxopropanoate (PubChem CID 69335328) has the molecular formula C14H22N2O3
and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-ethylhexyl 3-(1H-imidazol-5-yl)-3-oxopropanoate.
Molecular Properties
| Compound Name | 2-ethylhexyl 3-(1H-imidazol-5-yl)-3-oxopropanoate |
| PubChem CID | 69335328 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 2-ethylhexyl 3-(1H-imidazol-5-yl)-3-oxopropanoate |
| SMILES | CCCCC(CC)COC(=O)CC(=O)c1cnc[nH]1 |
| InChI | InChI=1S/C14H22N2O3/c1-3-5-6-11(4-2)9-19-14(18)7-13(17)12-8-15-10-16-12/h8,10-11H,3-7,9H2,1-2H3,(H,15,16) |
| InChIKey | BOVOGGDBVSXOME-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylhexyl 3-(1H-imidazol-5-yl)-3-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexyl 3-(1H-imidazol-5-yl)-3-oxopropanoate?
The IUPAC name of 2-ethylhexyl 3-(1H-imidazol-5-yl)-3-oxopropanoate (CID 69335328) is 2-ethylhexyl 3-(1H-imidazol-5-yl)-3-oxopropanoate.
What is the SMILES notation for 2-ethylhexyl 3-(1H-imidazol-5-yl)-3-oxopropanoate?
The canonical SMILES for 2-ethylhexyl 3-(1H-imidazol-5-yl)-3-oxopropanoate is CCCCC(CC)COC(=O)CC(=O)c1cnc[nH]1.
What is the InChIKey of 2-ethylhexyl 3-(1H-imidazol-5-yl)-3-oxopropanoate?
The InChIKey is BOVOGGDBVSXOME-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O3/c1-3-5-6-11(4-2)9-19-14(18)7-13(17)12-8-15-10-16-12/h8,10-11H,3-7,9H2,1-2H3,(H,15,16).
What are the key properties of 2-ethylhexyl 3-(1H-imidazol-5-yl)-3-oxopropanoate?
2-ethylhexyl 3-(1H-imidazol-5-yl)-3-oxopropanoate has a molecular weight of 266.34 g/mol, XLogP of 2.74, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexyl 3-(1H-imidazol-5-yl)-3-oxopropanoate is sourced from PubChem (CID 69335328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).