About 6-methoxy-3,4-dihydro-2H-chromene-4-carboxylic acid;3-phenylpiperidin-4-amine
6-methoxy-3,4-dihydro-2H-chromene-4-carboxylic acid;3-phenylpiperidin-4-amine (PubChem CID 69335562) has the molecular formula C22H28N2O4
and a molecular weight of 384.48 g/mol. Its IUPAC name is 6-methoxy-3,4-dihydro-2H-chromene-4-carboxylic acid;3-phenylpiperidin-4-amine.
Molecular Properties
| Compound Name | 6-methoxy-3,4-dihydro-2H-chromene-4-carboxylic acid;3-phenylpiperidin-4-amine |
| PubChem CID | 69335562 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 6-methoxy-3,4-dihydro-2H-chromene-4-carboxylic acid;3-phenylpiperidin-4-amine |
| SMILES | COc1ccc2c(c1)C(C(=O)O)CCO2.NC1CCNCC1c1ccccc1 |
| InChI | InChI=1S/C11H16N2.C11H12O4/c12-11-6-7-13-8-10(11)9-4-2-1-3-5-9;1-14-7-2-3-10-9(6-7)8(11(12)13)4-5-15-10/h1-5,10-11,13H,6-8,12H2;2-3,6,8H,4-5H2,1H3,(H,12,13) |
| InChIKey | AQKSWTBTMCVSKW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-methoxy-3,4-dihydro-2H-chromene-4-carboxylic acid;3-phenylpiperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-3,4-dihydro-2H-chromene-4-carboxylic acid;3-phenylpiperidin-4-amine?
The IUPAC name of 6-methoxy-3,4-dihydro-2H-chromene-4-carboxylic acid;3-phenylpiperidin-4-amine (CID 69335562) is 6-methoxy-3,4-dihydro-2H-chromene-4-carboxylic acid;3-phenylpiperidin-4-amine.
What is the SMILES notation for 6-methoxy-3,4-dihydro-2H-chromene-4-carboxylic acid;3-phenylpiperidin-4-amine?
The canonical SMILES for 6-methoxy-3,4-dihydro-2H-chromene-4-carboxylic acid;3-phenylpiperidin-4-amine is COc1ccc2c(c1)C(C(=O)O)CCO2.NC1CCNCC1c1ccccc1.
What is the InChIKey of 6-methoxy-3,4-dihydro-2H-chromene-4-carboxylic acid;3-phenylpiperidin-4-amine?
The InChIKey is AQKSWTBTMCVSKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2.C11H12O4/c12-11-6-7-13-8-10(11)9-4-2-1-3-5-9;1-14-7-2-3-10-9(6-7)8(11(12)13)4-5-15-10/h1-5,10-11,13H,6-8,12H2;2-3,6,8H,4-5H2,1H3,(H,12,13).
What are the key properties of 6-methoxy-3,4-dihydro-2H-chromene-4-carboxylic acid;3-phenylpiperidin-4-amine?
6-methoxy-3,4-dihydro-2H-chromene-4-carboxylic acid;3-phenylpiperidin-4-amine has a molecular weight of 384.48 g/mol, XLogP of 2.74, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-3,4-dihydro-2H-chromene-4-carboxylic acid;3-phenylpiperidin-4-amine is sourced from PubChem (CID 69335562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).