About [5,6-bis(4-chlorophenyl)pyrazin-2-yl] N-piperidin-1-ylcarbamate
[5,6-bis(4-chlorophenyl)pyrazin-2-yl] N-piperidin-1-ylcarbamate (PubChem CID 69335881) has the molecular formula C22H20Cl2N4O2
and a molecular weight of 443.33 g/mol. Its IUPAC name is [5,6-bis(4-chlorophenyl)pyrazin-2-yl] N-piperidin-1-ylcarbamate.
Molecular Properties
| Compound Name | [5,6-bis(4-chlorophenyl)pyrazin-2-yl] N-piperidin-1-ylcarbamate |
| PubChem CID | 69335881 |
| Molecular Formula | C22H20Cl2N4O2 |
| Molecular Weight | 443.33 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | [5,6-bis(4-chlorophenyl)pyrazin-2-yl] N-piperidin-1-ylcarbamate |
| SMILES | O=C(NN1CCCCC1)Oc1cnc(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C22H20Cl2N4O2/c23-17-8-4-15(5-9-17)20-21(16-6-10-18(24)11-7-16)26-19(14-25-20)30-22(29)27-28-12-2-1-3-13-28/h4-11,14H,1-3,12-13H2,(H,27,29) |
| InChIKey | GMJCGRRXTIYAMU-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.33 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5,6-bis(4-chlorophenyl)pyrazin-2-yl] N-piperidin-1-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5,6-bis(4-chlorophenyl)pyrazin-2-yl] N-piperidin-1-ylcarbamate?
The IUPAC name of [5,6-bis(4-chlorophenyl)pyrazin-2-yl] N-piperidin-1-ylcarbamate (CID 69335881) is [5,6-bis(4-chlorophenyl)pyrazin-2-yl] N-piperidin-1-ylcarbamate.
What is the SMILES notation for [5,6-bis(4-chlorophenyl)pyrazin-2-yl] N-piperidin-1-ylcarbamate?
The canonical SMILES for [5,6-bis(4-chlorophenyl)pyrazin-2-yl] N-piperidin-1-ylcarbamate is O=C(NN1CCCCC1)Oc1cnc(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2)n1.
What is the InChIKey of [5,6-bis(4-chlorophenyl)pyrazin-2-yl] N-piperidin-1-ylcarbamate?
The InChIKey is GMJCGRRXTIYAMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20Cl2N4O2/c23-17-8-4-15(5-9-17)20-21(16-6-10-18(24)11-7-16)26-19(14-25-20)30-22(29)27-28-12-2-1-3-13-28/h4-11,14H,1-3,12-13H2,(H,27,29).
What are the key properties of [5,6-bis(4-chlorophenyl)pyrazin-2-yl] N-piperidin-1-ylcarbamate?
[5,6-bis(4-chlorophenyl)pyrazin-2-yl] N-piperidin-1-ylcarbamate has a molecular weight of 443.33 g/mol, XLogP of 5.61, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5,6-bis(4-chlorophenyl)pyrazin-2-yl] N-piperidin-1-ylcarbamate is sourced from PubChem (CID 69335881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).