C22H14ClF3N2O2 — CID 69335904
3-(4-aminophenyl)-4-(5-chloro-2-hydroxyphenyl)-8-(trifluoromethyl)-1H-quinolin-2-one (PubChem CID 69335904) has the molecular formula C22H14ClF3N2O2 and a molecular weight of 430.81 g/mol. Its IUPAC name is 3-(4-aminophenyl)-4-(5-chloro-2-hydroxyphenyl)-8-(trifluoromethyl)-1H-quinolin-2-one.
| Compound Name | 3-(4-aminophenyl)-4-(5-chloro-2-hydroxyphenyl)-8-(trifluoromethyl)-1H-quinolin-2-one |
|---|---|
| PubChem CID | 69335904 |
| Molecular Formula | C22H14ClF3N2O2 |
| Molecular Weight | 430.81 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | 3-(4-aminophenyl)-4-(5-chloro-2-hydroxyphenyl)-8-(trifluoromethyl)-1H-quinolin-2-one |
| SMILES | Nc1ccc(-c2c(-c3cc(Cl)ccc3O)c3cccc(C(F)(F)F)c3[nH]c2=O)cc1 |
| InChI | InChI=1S/C22H14ClF3N2O2/c23-12-6-9-17(29)15(10-12)19-14-2-1-3-16(22(24,25)26)20(14)28-21(30)18(19)11-4-7-13(27)8-5-11/h1-10,29H,27H2,(H,28,30) |
| InChIKey | AHKLMNWODHNXCO-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.81 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|