About [5,6-bis(2-chlorophenyl)pyrazin-2-yl] N-cyclohexylcarbamate
[5,6-bis(2-chlorophenyl)pyrazin-2-yl] N-cyclohexylcarbamate (PubChem CID 69335954) has the molecular formula C23H21Cl2N3O2
and a molecular weight of 442.35 g/mol. Its IUPAC name is [5,6-bis(2-chlorophenyl)pyrazin-2-yl] N-cyclohexylcarbamate.
Molecular Properties
| Compound Name | [5,6-bis(2-chlorophenyl)pyrazin-2-yl] N-cyclohexylcarbamate |
| PubChem CID | 69335954 |
| Molecular Formula | C23H21Cl2N3O2 |
| Molecular Weight | 442.35 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | [5,6-bis(2-chlorophenyl)pyrazin-2-yl] N-cyclohexylcarbamate |
| SMILES | O=C(NC1CCCCC1)Oc1cnc(-c2ccccc2Cl)c(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C23H21Cl2N3O2/c24-18-12-6-4-10-16(18)21-22(17-11-5-7-13-19(17)25)28-20(14-26-21)30-23(29)27-15-8-2-1-3-9-15/h4-7,10-15H,1-3,8-9H2,(H,27,29) |
| InChIKey | HEPMLTRVMFWHFD-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.35 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5,6-bis(2-chlorophenyl)pyrazin-2-yl] N-cyclohexylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5,6-bis(2-chlorophenyl)pyrazin-2-yl] N-cyclohexylcarbamate?
The IUPAC name of [5,6-bis(2-chlorophenyl)pyrazin-2-yl] N-cyclohexylcarbamate (CID 69335954) is [5,6-bis(2-chlorophenyl)pyrazin-2-yl] N-cyclohexylcarbamate.
What is the SMILES notation for [5,6-bis(2-chlorophenyl)pyrazin-2-yl] N-cyclohexylcarbamate?
The canonical SMILES for [5,6-bis(2-chlorophenyl)pyrazin-2-yl] N-cyclohexylcarbamate is O=C(NC1CCCCC1)Oc1cnc(-c2ccccc2Cl)c(-c2ccccc2Cl)n1.
What is the InChIKey of [5,6-bis(2-chlorophenyl)pyrazin-2-yl] N-cyclohexylcarbamate?
The InChIKey is HEPMLTRVMFWHFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21Cl2N3O2/c24-18-12-6-4-10-16(18)21-22(17-11-5-7-13-19(17)25)28-20(14-26-21)30-23(29)27-15-8-2-1-3-9-15/h4-7,10-15H,1-3,8-9H2,(H,27,29).
What are the key properties of [5,6-bis(2-chlorophenyl)pyrazin-2-yl] N-cyclohexylcarbamate?
[5,6-bis(2-chlorophenyl)pyrazin-2-yl] N-cyclohexylcarbamate has a molecular weight of 442.35 g/mol, XLogP of 6.54, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5,6-bis(2-chlorophenyl)pyrazin-2-yl] N-cyclohexylcarbamate is sourced from PubChem (CID 69335954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).