C33H34Cl2N4O4S — CID 69336309
methyl 3-[2-[(2S)-1-[2-chloro-2-[3-chloro-4-[(1-methylindole-3-carbonyl)amino]phenyl]acetyl]-2,3,3a,4,5,6,7,7a-octahydroindol-2-yl]-1,3-thiazol-5-yl]propanoate (PubChem CID 69336309) has the molecular formula C33H34Cl2N4O4S and a molecular weight of 653.63 g/mol. Its IUPAC name is methyl 3-[2-[(2S)-1-[2-chloro-2-[3-chloro-4-[(1-methylindole-3-carbonyl)amino]phenyl]acetyl]-2,3,3a,4,5,6,7,7a-octahydroindol-2-yl]-1,3-thiazol-5-yl]propanoate.
| Compound Name | methyl 3-[2-[(2S)-1-[2-chloro-2-[3-chloro-4-[(1-methylindole-3-carbonyl)amino]phenyl]acetyl]-2,3,3a,4,5,6,7,7a-octahydroindol-2-yl]-1,3-thiazol-5-yl]propanoate |
|---|---|
| PubChem CID | 69336309 |
| Molecular Formula | C33H34Cl2N4O4S |
| Molecular Weight | 653.63 g/mol |
| Exact Mass | 652.17 |
| IUPAC Name | methyl 3-[2-[(2S)-1-[2-chloro-2-[3-chloro-4-[(1-methylindole-3-carbonyl)amino]phenyl]acetyl]-2,3,3a,4,5,6,7,7a-octahydroindol-2-yl]-1,3-thiazol-5-yl]propanoate |
| SMILES | COC(=O)CCc1cnc([C@@H]2CC3CCCCC3N2C(=O)C(Cl)c2ccc(NC(=O)c3cn(C)c4ccccc34)c(Cl)c2)s1 |
| InChI | InChI=1S/C33H34Cl2N4O4S/c1-38-18-23(22-8-4-6-10-27(22)38)31(41)37-25-13-11-20(15-24(25)34)30(35)33(42)39-26-9-5-3-7-19(26)16-28(39)32-36-17-21(44-32)12-14-29(40)43-2/h4,6,8,10-11,13,15,17-19,26,28,30H,3,5,7,9,12,14,16H2,1-2H3,(H,37,41)/t19?,26?,28-,30?/m0/s1 |
| InChIKey | JWCLJAPFEKRTQP-UPFBNWQCSA-N |
| XLogP | 7.46 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.63 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|