About [2-(3,5-Difluorophenyl)ethenyl](hydroxy)boranyl
[2-(3,5-Difluorophenyl)ethenyl](hydroxy)boranyl (PubChem CID 69337151) has the molecular formula C8H6BF2O
and a molecular weight of 166.94 g/mol.
Molecular Properties
| Compound Name | [2-(3,5-Difluorophenyl)ethenyl](hydroxy)boranyl |
| PubChem CID | 69337151 |
| Molecular Formula | C8H6BF2O |
| Molecular Weight | 166.94 g/mol |
| Exact Mass | 167.05 |
| IUPAC Name | — |
| SMILES | O[B]C=Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C8H6BF2O/c10-7-3-6(1-2-9-12)4-8(11)5-7/h1-5,12H |
| InChIKey | UAUOXNQIWWCHNH-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.94 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [2-(3,5-Difluorophenyl)ethenyl](hydroxy)boranyl with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3,5-Difluorophenyl)ethenyl](hydroxy)boranyl?
The IUPAC name of [2-(3,5-Difluorophenyl)ethenyl](hydroxy)boranyl (CID 69337151) is not available.
What is the SMILES notation for [2-(3,5-Difluorophenyl)ethenyl](hydroxy)boranyl?
The canonical SMILES for [2-(3,5-Difluorophenyl)ethenyl](hydroxy)boranyl is O[B]C=Cc1cc(F)cc(F)c1.
What is the InChIKey of [2-(3,5-Difluorophenyl)ethenyl](hydroxy)boranyl?
The InChIKey is UAUOXNQIWWCHNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BF2O/c10-7-3-6(1-2-9-12)4-8(11)5-7/h1-5,12H.
What are the key properties of [2-(3,5-Difluorophenyl)ethenyl](hydroxy)boranyl?
[2-(3,5-Difluorophenyl)ethenyl](hydroxy)boranyl has a molecular weight of 166.94 g/mol, XLogP of 1.55, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,5-Difluorophenyl)ethenyl](hydroxy)boranyl is sourced from PubChem (CID 69337151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).