About propyl 11-(2,5-dioxopyrrol-1-yl)undecanoate
propyl 11-(2,5-dioxopyrrol-1-yl)undecanoate (PubChem CID 69337168) has the molecular formula C18H29NO4
and a molecular weight of 323.43 g/mol. Its IUPAC name is propyl 11-(2,5-dioxopyrrol-1-yl)undecanoate.
Molecular Properties
| Compound Name | propyl 11-(2,5-dioxopyrrol-1-yl)undecanoate |
| PubChem CID | 69337168 |
| Molecular Formula | C18H29NO4 |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | propyl 11-(2,5-dioxopyrrol-1-yl)undecanoate |
| SMILES | CCCOC(=O)CCCCCCCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C18H29NO4/c1-2-15-23-18(22)11-9-7-5-3-4-6-8-10-14-19-16(20)12-13-17(19)21/h12-13H,2-11,14-15H2,1H3 |
| InChIKey | SZENFMWRCGZJLJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze propyl 11-(2,5-dioxopyrrol-1-yl)undecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 11-(2,5-dioxopyrrol-1-yl)undecanoate?
The IUPAC name of propyl 11-(2,5-dioxopyrrol-1-yl)undecanoate (CID 69337168) is propyl 11-(2,5-dioxopyrrol-1-yl)undecanoate.
What is the SMILES notation for propyl 11-(2,5-dioxopyrrol-1-yl)undecanoate?
The canonical SMILES for propyl 11-(2,5-dioxopyrrol-1-yl)undecanoate is CCCOC(=O)CCCCCCCCCCN1C(=O)C=CC1=O.
What is the InChIKey of propyl 11-(2,5-dioxopyrrol-1-yl)undecanoate?
The InChIKey is SZENFMWRCGZJLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29NO4/c1-2-15-23-18(22)11-9-7-5-3-4-6-8-10-14-19-16(20)12-13-17(19)21/h12-13H,2-11,14-15H2,1H3.
What are the key properties of propyl 11-(2,5-dioxopyrrol-1-yl)undecanoate?
propyl 11-(2,5-dioxopyrrol-1-yl)undecanoate has a molecular weight of 323.43 g/mol, XLogP of 3.38, 13 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 11-(2,5-dioxopyrrol-1-yl)undecanoate is sourced from PubChem (CID 69337168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).