C26H34F3N7O4 — CID 69337232
(2S)-N,1-dimethyl-N-[4-[[[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]pyrrolidine-2-carboxamide (PubChem CID 69337232) has the molecular formula C26H34F3N7O4 and a molecular weight of 565.60 g/mol. Its IUPAC name is (2S)-N,1-dimethyl-N-[4-[[[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N,1-dimethyl-N-[4-[[[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 69337232 |
| Molecular Formula | C26H34F3N7O4 |
| Molecular Weight | 565.60 g/mol |
| Exact Mass | 565.26 |
| IUPAC Name | (2S)-N,1-dimethyl-N-[4-[[[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]pyrrolidine-2-carboxamide |
| SMILES | CN(C(=O)[C@@H]1CCCN1C)C1CCC(CNc2nc(NCc3ccccc3OC(F)(F)F)ncc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C26H34F3N7O4/c1-34-13-5-7-20(34)24(37)35(2)19-11-9-17(10-12-19)14-30-23-21(36(38)39)16-32-25(33-23)31-15-18-6-3-4-8-22(18)40-26(27,28)29/h3-4,6,8,16-17,19-20H,5,7,9-15H2,1-2H3,(H2,30,31,32,33)/t17?,19?,20-/m0/s1 |
| InChIKey | VISLEMHDMYERCU-UUKMXZOPSA-N |
| XLogP | 4.42 |
| TPSA | 125.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.60 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|