About butyl 6-(2,5-dioxopyrrol-1-yl)hexanoate
butyl 6-(2,5-dioxopyrrol-1-yl)hexanoate (PubChem CID 69337666) has the molecular formula C14H21NO4
and a molecular weight of 267.32 g/mol. Its IUPAC name is butyl 6-(2,5-dioxopyrrol-1-yl)hexanoate.
Molecular Properties
| Compound Name | butyl 6-(2,5-dioxopyrrol-1-yl)hexanoate |
| PubChem CID | 69337666 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | butyl 6-(2,5-dioxopyrrol-1-yl)hexanoate |
| SMILES | CCCCOC(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C14H21NO4/c1-2-3-11-19-14(18)7-5-4-6-10-15-12(16)8-9-13(15)17/h8-9H,2-7,10-11H2,1H3 |
| InChIKey | QILFJKPHWWRULS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze butyl 6-(2,5-dioxopyrrol-1-yl)hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 6-(2,5-dioxopyrrol-1-yl)hexanoate?
The IUPAC name of butyl 6-(2,5-dioxopyrrol-1-yl)hexanoate (CID 69337666) is butyl 6-(2,5-dioxopyrrol-1-yl)hexanoate.
What is the SMILES notation for butyl 6-(2,5-dioxopyrrol-1-yl)hexanoate?
The canonical SMILES for butyl 6-(2,5-dioxopyrrol-1-yl)hexanoate is CCCCOC(=O)CCCCCN1C(=O)C=CC1=O.
What is the InChIKey of butyl 6-(2,5-dioxopyrrol-1-yl)hexanoate?
The InChIKey is QILFJKPHWWRULS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO4/c1-2-3-11-19-14(18)7-5-4-6-10-15-12(16)8-9-13(15)17/h8-9H,2-7,10-11H2,1H3.
What are the key properties of butyl 6-(2,5-dioxopyrrol-1-yl)hexanoate?
butyl 6-(2,5-dioxopyrrol-1-yl)hexanoate has a molecular weight of 267.32 g/mol, XLogP of 1.82, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 6-(2,5-dioxopyrrol-1-yl)hexanoate is sourced from PubChem (CID 69337666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).