About 3-methylbutyl 3-(2,5-dioxopyrrol-1-yl)propanoate
3-methylbutyl 3-(2,5-dioxopyrrol-1-yl)propanoate (PubChem CID 69338033) has the molecular formula C12H17NO4
and a molecular weight of 239.27 g/mol. Its IUPAC name is 3-methylbutyl 3-(2,5-dioxopyrrol-1-yl)propanoate.
Molecular Properties
| Compound Name | 3-methylbutyl 3-(2,5-dioxopyrrol-1-yl)propanoate |
| PubChem CID | 69338033 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 3-methylbutyl 3-(2,5-dioxopyrrol-1-yl)propanoate |
| SMILES | CC(C)CCOC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C12H17NO4/c1-9(2)6-8-17-12(16)5-7-13-10(14)3-4-11(13)15/h3-4,9H,5-8H2,1-2H3 |
| InChIKey | CHVAUTVADQOWCU-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbutyl 3-(2,5-dioxopyrrol-1-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutyl 3-(2,5-dioxopyrrol-1-yl)propanoate?
The IUPAC name of 3-methylbutyl 3-(2,5-dioxopyrrol-1-yl)propanoate (CID 69338033) is 3-methylbutyl 3-(2,5-dioxopyrrol-1-yl)propanoate.
What is the SMILES notation for 3-methylbutyl 3-(2,5-dioxopyrrol-1-yl)propanoate?
The canonical SMILES for 3-methylbutyl 3-(2,5-dioxopyrrol-1-yl)propanoate is CC(C)CCOC(=O)CCN1C(=O)C=CC1=O.
What is the InChIKey of 3-methylbutyl 3-(2,5-dioxopyrrol-1-yl)propanoate?
The InChIKey is CHVAUTVADQOWCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO4/c1-9(2)6-8-17-12(16)5-7-13-10(14)3-4-11(13)15/h3-4,9H,5-8H2,1-2H3.
What are the key properties of 3-methylbutyl 3-(2,5-dioxopyrrol-1-yl)propanoate?
3-methylbutyl 3-(2,5-dioxopyrrol-1-yl)propanoate has a molecular weight of 239.27 g/mol, XLogP of 0.89, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutyl 3-(2,5-dioxopyrrol-1-yl)propanoate is sourced from PubChem (CID 69338033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).