About potassium (11R)-2,10-dioxo-1-azabicyclo[9.3.0]tetradecane-11-carboxylate
potassium (11R)-2,10-dioxo-1-azabicyclo[9.3.0]tetradecane-11-carboxylate (PubChem CID 69338045) has the molecular formula C14H20KNO4
and a molecular weight of 305.42 g/mol. Its IUPAC name is potassium (11R)-2,10-dioxo-1-azabicyclo[9.3.0]tetradecane-11-carboxylate.
Molecular Properties
| Compound Name | potassium (11R)-2,10-dioxo-1-azabicyclo[9.3.0]tetradecane-11-carboxylate |
| PubChem CID | 69338045 |
| Molecular Formula | C14H20KNO4 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | potassium (11R)-2,10-dioxo-1-azabicyclo[9.3.0]tetradecane-11-carboxylate |
| SMILES | O=C1CCCCCCCC(=O)[C@@]2(C(=O)[O-])CCCN12.[K+] |
| InChI | InChI=1S/C14H21NO4.K/c16-11-7-4-2-1-3-5-8-12(17)15-10-6-9-14(11,15)13(18)19;/h1-10H2,(H,18,19);/q;+1/p-1/t14-;/m1./s1 |
| InChIKey | XFXSCNKQACINIE-PFEQFJNWSA-M |
| XLogP | -2.59 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze potassium (11R)-2,10-dioxo-1-azabicyclo[9.3.0]tetradecane-11-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium (11R)-2,10-dioxo-1-azabicyclo[9.3.0]tetradecane-11-carboxylate?
The IUPAC name of potassium (11R)-2,10-dioxo-1-azabicyclo[9.3.0]tetradecane-11-carboxylate (CID 69338045) is potassium (11R)-2,10-dioxo-1-azabicyclo[9.3.0]tetradecane-11-carboxylate.
What is the SMILES notation for potassium (11R)-2,10-dioxo-1-azabicyclo[9.3.0]tetradecane-11-carboxylate?
The canonical SMILES for potassium (11R)-2,10-dioxo-1-azabicyclo[9.3.0]tetradecane-11-carboxylate is O=C1CCCCCCCC(=O)[C@@]2(C(=O)[O-])CCCN12.[K+].
What is the InChIKey of potassium (11R)-2,10-dioxo-1-azabicyclo[9.3.0]tetradecane-11-carboxylate?
The InChIKey is XFXSCNKQACINIE-PFEQFJNWSA-M. The full InChI is InChI=1S/C14H21NO4.K/c16-11-7-4-2-1-3-5-8-12(17)15-10-6-9-14(11,15)13(18)19;/h1-10H2,(H,18,19);/q;+1/p-1/t14-;/m1./s1.
What are the key properties of potassium (11R)-2,10-dioxo-1-azabicyclo[9.3.0]tetradecane-11-carboxylate?
potassium (11R)-2,10-dioxo-1-azabicyclo[9.3.0]tetradecane-11-carboxylate has a molecular weight of 305.42 g/mol, XLogP of -2.59, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium (11R)-2,10-dioxo-1-azabicyclo[9.3.0]tetradecane-11-carboxylate is sourced from PubChem (CID 69338045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).