About bicyclo[3.1.0]hexa-1(6),2,4-triene;methyl acetate
bicyclo[3.1.0]hexa-1(6),2,4-triene;methyl acetate (PubChem CID 69338270) has the molecular formula C9H10O2
and a molecular weight of 150.18 g/mol. Its IUPAC name is bicyclo[3.1.0]hexa-1(6),2,4-triene;methyl acetate.
Molecular Properties
| Compound Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;methyl acetate |
| PubChem CID | 69338270 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;methyl acetate |
| SMILES | COC(C)=O.c1cc2cc-2c1 |
| InChI | InChI=1S/C6H4.C3H6O2/c1-2-5-4-6(5)3-1;1-3(4)5-2/h1-4H;1-2H3 |
| InChIKey | CQGQFOANZZXPEV-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bicyclo[3.1.0]hexa-1(6),2,4-triene;methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[3.1.0]hexa-1(6),2,4-triene;methyl acetate?
The IUPAC name of bicyclo[3.1.0]hexa-1(6),2,4-triene;methyl acetate (CID 69338270) is bicyclo[3.1.0]hexa-1(6),2,4-triene;methyl acetate.
What is the SMILES notation for bicyclo[3.1.0]hexa-1(6),2,4-triene;methyl acetate?
The canonical SMILES for bicyclo[3.1.0]hexa-1(6),2,4-triene;methyl acetate is COC(C)=O.c1cc2cc-2c1.
What is the InChIKey of bicyclo[3.1.0]hexa-1(6),2,4-triene;methyl acetate?
The InChIKey is CQGQFOANZZXPEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4.C3H6O2/c1-2-5-4-6(5)3-1;1-3(4)5-2/h1-4H;1-2H3.
What are the key properties of bicyclo[3.1.0]hexa-1(6),2,4-triene;methyl acetate?
bicyclo[3.1.0]hexa-1(6),2,4-triene;methyl acetate has a molecular weight of 150.18 g/mol, XLogP of 1.85, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[3.1.0]hexa-1(6),2,4-triene;methyl acetate is sourced from PubChem (CID 69338270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).