About (E)-3-cyclopentyl-5-(dimethylamino)-1-(4-fluorophenyl)-2,4-dimethylpent-1-en-3-ol
(E)-3-cyclopentyl-5-(dimethylamino)-1-(4-fluorophenyl)-2,4-dimethylpent-1-en-3-ol (PubChem CID 69338484) has the molecular formula C20H30FNO
and a molecular weight of 319.46 g/mol. Its IUPAC name is (E)-3-cyclopentyl-5-(dimethylamino)-1-(4-fluorophenyl)-2,4-dimethylpent-1-en-3-ol.
Molecular Properties
| Compound Name | (E)-3-cyclopentyl-5-(dimethylamino)-1-(4-fluorophenyl)-2,4-dimethylpent-1-en-3-ol |
| PubChem CID | 69338484 |
| Molecular Formula | C20H30FNO |
| Molecular Weight | 319.46 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | (E)-3-cyclopentyl-5-(dimethylamino)-1-(4-fluorophenyl)-2,4-dimethylpent-1-en-3-ol |
| SMILES | C/C(=C\c1ccc(F)cc1)C(O)(C(C)CN(C)C)C1CCCC1 |
| InChI | InChI=1S/C20H30FNO/c1-15(13-17-9-11-19(21)12-10-17)20(23,16(2)14-22(3)4)18-7-5-6-8-18/h9-13,16,18,23H,5-8,14H2,1-4H3/b15-13+ |
| InChIKey | MCGGQUIRUKYNSJ-FYWRMAATSA-N |
| XLogP | 4.35 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.46 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (E)-3-cyclopentyl-5-(dimethylamino)-1-(4-fluorophenyl)-2,4-dimethylpent-1-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-cyclopentyl-5-(dimethylamino)-1-(4-fluorophenyl)-2,4-dimethylpent-1-en-3-ol?
The IUPAC name of (E)-3-cyclopentyl-5-(dimethylamino)-1-(4-fluorophenyl)-2,4-dimethylpent-1-en-3-ol (CID 69338484) is (E)-3-cyclopentyl-5-(dimethylamino)-1-(4-fluorophenyl)-2,4-dimethylpent-1-en-3-ol.
What is the SMILES notation for (E)-3-cyclopentyl-5-(dimethylamino)-1-(4-fluorophenyl)-2,4-dimethylpent-1-en-3-ol?
The canonical SMILES for (E)-3-cyclopentyl-5-(dimethylamino)-1-(4-fluorophenyl)-2,4-dimethylpent-1-en-3-ol is C/C(=C\c1ccc(F)cc1)C(O)(C(C)CN(C)C)C1CCCC1.
What is the InChIKey of (E)-3-cyclopentyl-5-(dimethylamino)-1-(4-fluorophenyl)-2,4-dimethylpent-1-en-3-ol?
The InChIKey is MCGGQUIRUKYNSJ-FYWRMAATSA-N. The full InChI is InChI=1S/C20H30FNO/c1-15(13-17-9-11-19(21)12-10-17)20(23,16(2)14-22(3)4)18-7-5-6-8-18/h9-13,16,18,23H,5-8,14H2,1-4H3/b15-13+.
What are the key properties of (E)-3-cyclopentyl-5-(dimethylamino)-1-(4-fluorophenyl)-2,4-dimethylpent-1-en-3-ol?
(E)-3-cyclopentyl-5-(dimethylamino)-1-(4-fluorophenyl)-2,4-dimethylpent-1-en-3-ol has a molecular weight of 319.46 g/mol, XLogP of 4.35, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-cyclopentyl-5-(dimethylamino)-1-(4-fluorophenyl)-2,4-dimethylpent-1-en-3-ol is sourced from PubChem (CID 69338484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).