About 2-(4-methylphenyl)-1,3-thiazole-4-carboxylate
2-(4-methylphenyl)-1,3-thiazole-4-carboxylate (PubChem CID 6933854) has the molecular formula C11H8NO2S-
and a molecular weight of 218.26 g/mol. Its IUPAC name is 2-(4-methylphenyl)-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | 2-(4-methylphenyl)-1,3-thiazole-4-carboxylate |
| PubChem CID | 6933854 |
| Molecular Formula | C11H8NO2S- |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | 2-(4-methylphenyl)-1,3-thiazole-4-carboxylate |
| SMILES | Cc1ccc(-c2nc(C(=O)[O-])cs2)cc1 |
| InChI | InChI=1S/C11H9NO2S/c1-7-2-4-8(5-3-7)10-12-9(6-15-10)11(13)14/h2-6H,1H3,(H,13,14)/p-1 |
| InChIKey | MTVWIZYQYPRZGZ-UHFFFAOYSA-M |
| XLogP | 1.48 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-methylphenyl)-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylphenyl)-1,3-thiazole-4-carboxylate?
The IUPAC name of 2-(4-methylphenyl)-1,3-thiazole-4-carboxylate (CID 6933854) is 2-(4-methylphenyl)-1,3-thiazole-4-carboxylate.
What is the SMILES notation for 2-(4-methylphenyl)-1,3-thiazole-4-carboxylate?
The canonical SMILES for 2-(4-methylphenyl)-1,3-thiazole-4-carboxylate is Cc1ccc(-c2nc(C(=O)[O-])cs2)cc1.
What is the InChIKey of 2-(4-methylphenyl)-1,3-thiazole-4-carboxylate?
The InChIKey is MTVWIZYQYPRZGZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H9NO2S/c1-7-2-4-8(5-3-7)10-12-9(6-15-10)11(13)14/h2-6H,1H3,(H,13,14)/p-1.
What are the key properties of 2-(4-methylphenyl)-1,3-thiazole-4-carboxylate?
2-(4-methylphenyl)-1,3-thiazole-4-carboxylate has a molecular weight of 218.26 g/mol, XLogP of 1.48, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylphenyl)-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 6933854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).