About 3-[1-(dimethylamino)propan-2-yl]-2-methyl-1,6-diphenylhex-1-en-3-ol
3-[1-(dimethylamino)propan-2-yl]-2-methyl-1,6-diphenylhex-1-en-3-ol (PubChem CID 69338574) has the molecular formula C24H33NO
and a molecular weight of 351.53 g/mol. Its IUPAC name is 3-[1-(dimethylamino)propan-2-yl]-2-methyl-1,6-diphenylhex-1-en-3-ol.
Molecular Properties
| Compound Name | 3-[1-(dimethylamino)propan-2-yl]-2-methyl-1,6-diphenylhex-1-en-3-ol |
| PubChem CID | 69338574 |
| Molecular Formula | C24H33NO |
| Molecular Weight | 351.53 g/mol |
| Exact Mass | 351.26 |
| IUPAC Name | 3-[1-(dimethylamino)propan-2-yl]-2-methyl-1,6-diphenylhex-1-en-3-ol |
| SMILES | CC(=Cc1ccccc1)C(O)(CCCc1ccccc1)C(C)CN(C)C |
| InChI | InChI=1S/C24H33NO/c1-20(18-23-14-9-6-10-15-23)24(26,21(2)19-25(3)4)17-11-16-22-12-7-5-8-13-22/h5-10,12-15,18,21,26H,11,16-17,19H2,1-4H3 |
| InChIKey | NVNBZLYHSVQNDX-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.53 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[1-(dimethylamino)propan-2-yl]-2-methyl-1,6-diphenylhex-1-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(dimethylamino)propan-2-yl]-2-methyl-1,6-diphenylhex-1-en-3-ol?
The IUPAC name of 3-[1-(dimethylamino)propan-2-yl]-2-methyl-1,6-diphenylhex-1-en-3-ol (CID 69338574) is 3-[1-(dimethylamino)propan-2-yl]-2-methyl-1,6-diphenylhex-1-en-3-ol.
What is the SMILES notation for 3-[1-(dimethylamino)propan-2-yl]-2-methyl-1,6-diphenylhex-1-en-3-ol?
The canonical SMILES for 3-[1-(dimethylamino)propan-2-yl]-2-methyl-1,6-diphenylhex-1-en-3-ol is CC(=Cc1ccccc1)C(O)(CCCc1ccccc1)C(C)CN(C)C.
What is the InChIKey of 3-[1-(dimethylamino)propan-2-yl]-2-methyl-1,6-diphenylhex-1-en-3-ol?
The InChIKey is NVNBZLYHSVQNDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H33NO/c1-20(18-23-14-9-6-10-15-23)24(26,21(2)19-25(3)4)17-11-16-22-12-7-5-8-13-22/h5-10,12-15,18,21,26H,11,16-17,19H2,1-4H3.
What are the key properties of 3-[1-(dimethylamino)propan-2-yl]-2-methyl-1,6-diphenylhex-1-en-3-ol?
3-[1-(dimethylamino)propan-2-yl]-2-methyl-1,6-diphenylhex-1-en-3-ol has a molecular weight of 351.53 g/mol, XLogP of 5.04, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(dimethylamino)propan-2-yl]-2-methyl-1,6-diphenylhex-1-en-3-ol is sourced from PubChem (CID 69338574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).