C14H16INO4S — CID 69339486
2-iodo-1-(2-phenylethenylsulfonyl)piperidine-2-carboxylic acid (PubChem CID 69339486) has the molecular formula C14H16INO4S and a molecular weight of 421.26 g/mol. Its IUPAC name is 2-iodo-1-(2-phenylethenylsulfonyl)piperidine-2-carboxylic acid.
| Compound Name | 2-iodo-1-(2-phenylethenylsulfonyl)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 69339486 |
| Molecular Formula | C14H16INO4S |
| Molecular Weight | 421.26 g/mol |
| Exact Mass | 420.98 |
| IUPAC Name | 2-iodo-1-(2-phenylethenylsulfonyl)piperidine-2-carboxylic acid |
| SMILES | O=C(O)C1(I)CCCCN1S(=O)(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C14H16INO4S/c15-14(13(17)18)9-4-5-10-16(14)21(19,20)11-8-12-6-2-1-3-7-12/h1-3,6-8,11H,4-5,9-10H2,(H,17,18) |
| InChIKey | VULMINBMZYROFO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.26 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|