About (Z)-3-(2,3-dichlorophenyl)-5-(dimethylamino)-1-(4-fluorophenyl)-2,4-dimethylpent-1-en-3-ol
(Z)-3-(2,3-dichlorophenyl)-5-(dimethylamino)-1-(4-fluorophenyl)-2,4-dimethylpent-1-en-3-ol (PubChem CID 69339559) has the molecular formula C21H24Cl2FNO
and a molecular weight of 396.33 g/mol. Its IUPAC name is (Z)-3-(2,3-dichlorophenyl)-5-(dimethylamino)-1-(4-fluorophenyl)-2,4-dimethylpent-1-en-3-ol.
Molecular Properties
| Compound Name | (Z)-3-(2,3-dichlorophenyl)-5-(dimethylamino)-1-(4-fluorophenyl)-2,4-dimethylpent-1-en-3-ol |
| PubChem CID | 69339559 |
| Molecular Formula | C21H24Cl2FNO |
| Molecular Weight | 396.33 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | (Z)-3-(2,3-dichlorophenyl)-5-(dimethylamino)-1-(4-fluorophenyl)-2,4-dimethylpent-1-en-3-ol |
| SMILES | C/C(=C/c1ccc(F)cc1)C(O)(c1cccc(Cl)c1Cl)C(C)CN(C)C |
| InChI | InChI=1S/C21H24Cl2FNO/c1-14(12-16-8-10-17(24)11-9-16)21(26,15(2)13-25(3)4)18-6-5-7-19(22)20(18)23/h5-12,15,26H,13H2,1-4H3/b14-12- |
| InChIKey | VDPYWGKYGMNFRE-OWBHPGMISA-N |
| XLogP | 5.62 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.33 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (Z)-3-(2,3-dichlorophenyl)-5-(dimethylamino)-1-(4-fluorophenyl)-2,4-dimethylpent-1-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-(2,3-dichlorophenyl)-5-(dimethylamino)-1-(4-fluorophenyl)-2,4-dimethylpent-1-en-3-ol?
The IUPAC name of (Z)-3-(2,3-dichlorophenyl)-5-(dimethylamino)-1-(4-fluorophenyl)-2,4-dimethylpent-1-en-3-ol (CID 69339559) is (Z)-3-(2,3-dichlorophenyl)-5-(dimethylamino)-1-(4-fluorophenyl)-2,4-dimethylpent-1-en-3-ol.
What is the SMILES notation for (Z)-3-(2,3-dichlorophenyl)-5-(dimethylamino)-1-(4-fluorophenyl)-2,4-dimethylpent-1-en-3-ol?
The canonical SMILES for (Z)-3-(2,3-dichlorophenyl)-5-(dimethylamino)-1-(4-fluorophenyl)-2,4-dimethylpent-1-en-3-ol is C/C(=C/c1ccc(F)cc1)C(O)(c1cccc(Cl)c1Cl)C(C)CN(C)C.
What is the InChIKey of (Z)-3-(2,3-dichlorophenyl)-5-(dimethylamino)-1-(4-fluorophenyl)-2,4-dimethylpent-1-en-3-ol?
The InChIKey is VDPYWGKYGMNFRE-OWBHPGMISA-N. The full InChI is InChI=1S/C21H24Cl2FNO/c1-14(12-16-8-10-17(24)11-9-16)21(26,15(2)13-25(3)4)18-6-5-7-19(22)20(18)23/h5-12,15,26H,13H2,1-4H3/b14-12-.
What are the key properties of (Z)-3-(2,3-dichlorophenyl)-5-(dimethylamino)-1-(4-fluorophenyl)-2,4-dimethylpent-1-en-3-ol?
(Z)-3-(2,3-dichlorophenyl)-5-(dimethylamino)-1-(4-fluorophenyl)-2,4-dimethylpent-1-en-3-ol has a molecular weight of 396.33 g/mol, XLogP of 5.62, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-(2,3-dichlorophenyl)-5-(dimethylamino)-1-(4-fluorophenyl)-2,4-dimethylpent-1-en-3-ol is sourced from PubChem (CID 69339559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).