C20H25NOS — CID 69339564
2-benzylidene-6-[(dimethylamino)methyl]-1-thiophen-2-ylcyclohexan-1-ol (PubChem CID 69339564) has the molecular formula C20H25NOS and a molecular weight of 327.49 g/mol. Its IUPAC name is 2-benzylidene-6-[(dimethylamino)methyl]-1-thiophen-2-ylcyclohexan-1-ol.
| Compound Name | 2-benzylidene-6-[(dimethylamino)methyl]-1-thiophen-2-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 69339564 |
| Molecular Formula | C20H25NOS |
| Molecular Weight | 327.49 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 2-benzylidene-6-[(dimethylamino)methyl]-1-thiophen-2-ylcyclohexan-1-ol |
| SMILES | CN(C)CC1CCCC(=Cc2ccccc2)C1(O)c1cccs1 |
| InChI | InChI=1S/C20H25NOS/c1-21(2)15-18-11-6-10-17(14-16-8-4-3-5-9-16)20(18,22)19-12-7-13-23-19/h3-5,7-9,12-14,18,22H,6,10-11,15H2,1-2H3 |
| InChIKey | CWBHPNSZBFKXCG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |