About 5-spiro[1-azabicyclo[2.2.1]heptane-2,3'-pyrrolidine]-3-yl-1,2-thiazole
5-spiro[1-azabicyclo[2.2.1]heptane-2,3'-pyrrolidine]-3-yl-1,2-thiazole (PubChem CID 69340714) has the molecular formula C12H17N3S
and a molecular weight of 235.36 g/mol. Its IUPAC name is 5-spiro[1-azabicyclo[2.2.1]heptane-2,3'-pyrrolidine]-3-yl-1,2-thiazole.
Molecular Properties
| Compound Name | 5-spiro[1-azabicyclo[2.2.1]heptane-2,3'-pyrrolidine]-3-yl-1,2-thiazole |
| PubChem CID | 69340714 |
| Molecular Formula | C12H17N3S |
| Molecular Weight | 235.36 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 5-spiro[1-azabicyclo[2.2.1]heptane-2,3'-pyrrolidine]-3-yl-1,2-thiazole |
| SMILES | c1cc(C2C3CCN(C3)C23CCNC3)sn1 |
| InChI | InChI=1S/C12H17N3S/c1-4-14-16-10(1)11-9-2-6-15(7-9)12(11)3-5-13-8-12/h1,4,9,11,13H,2-3,5-8H2 |
| InChIKey | UQLNVAAWLAECKW-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.36 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-spiro[1-azabicyclo[2.2.1]heptane-2,3'-pyrrolidine]-3-yl-1,2-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-spiro[1-azabicyclo[2.2.1]heptane-2,3'-pyrrolidine]-3-yl-1,2-thiazole?
The IUPAC name of 5-spiro[1-azabicyclo[2.2.1]heptane-2,3'-pyrrolidine]-3-yl-1,2-thiazole (CID 69340714) is 5-spiro[1-azabicyclo[2.2.1]heptane-2,3'-pyrrolidine]-3-yl-1,2-thiazole.
What is the SMILES notation for 5-spiro[1-azabicyclo[2.2.1]heptane-2,3'-pyrrolidine]-3-yl-1,2-thiazole?
The canonical SMILES for 5-spiro[1-azabicyclo[2.2.1]heptane-2,3'-pyrrolidine]-3-yl-1,2-thiazole is c1cc(C2C3CCN(C3)C23CCNC3)sn1.
What is the InChIKey of 5-spiro[1-azabicyclo[2.2.1]heptane-2,3'-pyrrolidine]-3-yl-1,2-thiazole?
The InChIKey is UQLNVAAWLAECKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3S/c1-4-14-16-10(1)11-9-2-6-15(7-9)12(11)3-5-13-8-12/h1,4,9,11,13H,2-3,5-8H2.
What are the key properties of 5-spiro[1-azabicyclo[2.2.1]heptane-2,3'-pyrrolidine]-3-yl-1,2-thiazole?
5-spiro[1-azabicyclo[2.2.1]heptane-2,3'-pyrrolidine]-3-yl-1,2-thiazole has a molecular weight of 235.36 g/mol, XLogP of 1.29, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-spiro[1-azabicyclo[2.2.1]heptane-2,3'-pyrrolidine]-3-yl-1,2-thiazole is sourced from PubChem (CID 69340714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).