About 2-(4,5-diaminofuro[2,3-b]pyrrol-6-yl)oxyethanol
2-(4,5-diaminofuro[2,3-b]pyrrol-6-yl)oxyethanol (PubChem CID 69340972) has the molecular formula C8H11N3O3
and a molecular weight of 197.19 g/mol. Its IUPAC name is 2-(4,5-diaminofuro[2,3-b]pyrrol-6-yl)oxyethanol.
Molecular Properties
| Compound Name | 2-(4,5-diaminofuro[2,3-b]pyrrol-6-yl)oxyethanol |
| PubChem CID | 69340972 |
| Molecular Formula | C8H11N3O3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 2-(4,5-diaminofuro[2,3-b]pyrrol-6-yl)oxyethanol |
| SMILES | Nc1c(N)n(OCCO)c2occc12 |
| InChI | InChI=1S/C8H11N3O3/c9-6-5-1-3-13-8(5)11(7(6)10)14-4-2-12/h1,3,12H,2,4,9-10H2 |
| InChIKey | GIYHJZFSVFFLCC-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 99.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(4,5-diaminofuro[2,3-b]pyrrol-6-yl)oxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-diaminofuro[2,3-b]pyrrol-6-yl)oxyethanol?
The IUPAC name of 2-(4,5-diaminofuro[2,3-b]pyrrol-6-yl)oxyethanol (CID 69340972) is 2-(4,5-diaminofuro[2,3-b]pyrrol-6-yl)oxyethanol.
What is the SMILES notation for 2-(4,5-diaminofuro[2,3-b]pyrrol-6-yl)oxyethanol?
The canonical SMILES for 2-(4,5-diaminofuro[2,3-b]pyrrol-6-yl)oxyethanol is Nc1c(N)n(OCCO)c2occc12.
What is the InChIKey of 2-(4,5-diaminofuro[2,3-b]pyrrol-6-yl)oxyethanol?
The InChIKey is GIYHJZFSVFFLCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O3/c9-6-5-1-3-13-8(5)11(7(6)10)14-4-2-12/h1,3,12H,2,4,9-10H2.
What are the key properties of 2-(4,5-diaminofuro[2,3-b]pyrrol-6-yl)oxyethanol?
2-(4,5-diaminofuro[2,3-b]pyrrol-6-yl)oxyethanol has a molecular weight of 197.19 g/mol, XLogP of -0.18, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-diaminofuro[2,3-b]pyrrol-6-yl)oxyethanol is sourced from PubChem (CID 69340972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).