About 5-spiro[1-azoniabicyclo[2.2.1]heptane-7,3'-pyrrolidine]-1-yl-1,2-oxazole
5-spiro[1-azoniabicyclo[2.2.1]heptane-7,3'-pyrrolidine]-1-yl-1,2-oxazole (PubChem CID 69340977) has the molecular formula C12H18N3O+
and a molecular weight of 220.30 g/mol. Its IUPAC name is 5-spiro[1-azoniabicyclo[2.2.1]heptane-7,3'-pyrrolidine]-1-yl-1,2-oxazole.
Molecular Properties
| Compound Name | 5-spiro[1-azoniabicyclo[2.2.1]heptane-7,3'-pyrrolidine]-1-yl-1,2-oxazole |
| PubChem CID | 69340977 |
| Molecular Formula | C12H18N3O+ |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 5-spiro[1-azoniabicyclo[2.2.1]heptane-7,3'-pyrrolidine]-1-yl-1,2-oxazole |
| SMILES | c1cc([N+]23CCC(CC2)C32CCNC2)on1 |
| InChI | InChI=1S/C12H18N3O/c1-5-14-16-11(1)15-7-2-10(3-8-15)12(15)4-6-13-9-12/h1,5,10,13H,2-4,6-9H2/q+1 |
| InChIKey | JIKRLFYFTATALA-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 5-spiro[1-azoniabicyclo[2.2.1]heptane-7,3'-pyrrolidine]-1-yl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-spiro[1-azoniabicyclo[2.2.1]heptane-7,3'-pyrrolidine]-1-yl-1,2-oxazole?
The IUPAC name of 5-spiro[1-azoniabicyclo[2.2.1]heptane-7,3'-pyrrolidine]-1-yl-1,2-oxazole (CID 69340977) is 5-spiro[1-azoniabicyclo[2.2.1]heptane-7,3'-pyrrolidine]-1-yl-1,2-oxazole.
What is the SMILES notation for 5-spiro[1-azoniabicyclo[2.2.1]heptane-7,3'-pyrrolidine]-1-yl-1,2-oxazole?
The canonical SMILES for 5-spiro[1-azoniabicyclo[2.2.1]heptane-7,3'-pyrrolidine]-1-yl-1,2-oxazole is c1cc([N+]23CCC(CC2)C32CCNC2)on1.
What is the InChIKey of 5-spiro[1-azoniabicyclo[2.2.1]heptane-7,3'-pyrrolidine]-1-yl-1,2-oxazole?
The InChIKey is JIKRLFYFTATALA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N3O/c1-5-14-16-11(1)15-7-2-10(3-8-15)12(15)4-6-13-9-12/h1,5,10,13H,2-4,6-9H2/q+1.
What are the key properties of 5-spiro[1-azoniabicyclo[2.2.1]heptane-7,3'-pyrrolidine]-1-yl-1,2-oxazole?
5-spiro[1-azoniabicyclo[2.2.1]heptane-7,3'-pyrrolidine]-1-yl-1,2-oxazole has a molecular weight of 220.30 g/mol, XLogP of 1.14, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-spiro[1-azoniabicyclo[2.2.1]heptane-7,3'-pyrrolidine]-1-yl-1,2-oxazole is sourced from PubChem (CID 69340977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).