About 6-ethoxy-6-methylcyclohexa-2,4-dien-1-ol
6-ethoxy-6-methylcyclohexa-2,4-dien-1-ol (PubChem CID 69341266) has the molecular formula C9H14O2
and a molecular weight of 154.21 g/mol. Its IUPAC name is 6-ethoxy-6-methylcyclohexa-2,4-dien-1-ol.
Molecular Properties
| Compound Name | 6-ethoxy-6-methylcyclohexa-2,4-dien-1-ol |
| PubChem CID | 69341266 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | 6-ethoxy-6-methylcyclohexa-2,4-dien-1-ol |
| SMILES | CCOC1(C)C=CC=CC1O |
| InChI | InChI=1S/C9H14O2/c1-3-11-9(2)7-5-4-6-8(9)10/h4-8,10H,3H2,1-2H3 |
| InChIKey | BJRNTPVNRYKWCY-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-ethoxy-6-methylcyclohexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethoxy-6-methylcyclohexa-2,4-dien-1-ol?
The IUPAC name of 6-ethoxy-6-methylcyclohexa-2,4-dien-1-ol (CID 69341266) is 6-ethoxy-6-methylcyclohexa-2,4-dien-1-ol.
What is the SMILES notation for 6-ethoxy-6-methylcyclohexa-2,4-dien-1-ol?
The canonical SMILES for 6-ethoxy-6-methylcyclohexa-2,4-dien-1-ol is CCOC1(C)C=CC=CC1O.
What is the InChIKey of 6-ethoxy-6-methylcyclohexa-2,4-dien-1-ol?
The InChIKey is BJRNTPVNRYKWCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O2/c1-3-11-9(2)7-5-4-6-8(9)10/h4-8,10H,3H2,1-2H3.
What are the key properties of 6-ethoxy-6-methylcyclohexa-2,4-dien-1-ol?
6-ethoxy-6-methylcyclohexa-2,4-dien-1-ol has a molecular weight of 154.21 g/mol, XLogP of 1.27, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethoxy-6-methylcyclohexa-2,4-dien-1-ol is sourced from PubChem (CID 69341266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).