C12H22O — CID 69341481
4,5-dimethyl-2-pentan-3-yl-3,6-dihydro-2H-pyran (PubChem CID 69341481) has the molecular formula C12H22O and a molecular weight of 182.31 g/mol. Its IUPAC name is 4,5-dimethyl-2-pentan-3-yl-3,6-dihydro-2H-pyran.
| Compound Name | 4,5-dimethyl-2-pentan-3-yl-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 69341481 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | 4,5-dimethyl-2-pentan-3-yl-3,6-dihydro-2H-pyran |
| SMILES | CCC(CC)C1CC(C)=C(C)CO1 |
| InChI | InChI=1S/C12H22O/c1-5-11(6-2)12-7-9(3)10(4)8-13-12/h11-12H,5-8H2,1-4H3 |
| InChIKey | FZXOCBABUGICCW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|