C16H17N3O4 — CID 69342394
7,7-dimethyl-4-(2-nitrophenyl)-3,4,6,8-tetrahydro-1H-quinazoline-2,5-dione (PubChem CID 69342394) has the molecular formula C16H17N3O4 and a molecular weight of 315.33 g/mol. Its IUPAC name is 7,7-dimethyl-4-(2-nitrophenyl)-3,4,6,8-tetrahydro-1H-quinazoline-2,5-dione.
| Compound Name | 7,7-dimethyl-4-(2-nitrophenyl)-3,4,6,8-tetrahydro-1H-quinazoline-2,5-dione |
|---|---|
| PubChem CID | 69342394 |
| Molecular Formula | C16H17N3O4 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 7,7-dimethyl-4-(2-nitrophenyl)-3,4,6,8-tetrahydro-1H-quinazoline-2,5-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)NC(=O)NC2c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H17N3O4/c1-16(2)7-10-13(12(20)8-16)14(18-15(21)17-10)9-5-3-4-6-11(9)19(22)23/h3-6,14H,7-8H2,1-2H3,(H2,17,18,21) |
| InChIKey | NBRLYSPHKZIDRM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|