C14H18N3+ — CID 6934280
(5R)-1-aza-4-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-12-amine (PubChem CID 6934280) has the molecular formula C14H18N3+ and a molecular weight of 228.32 g/mol. Its IUPAC name is (5R)-1-aza-4-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-12-amine.
| Compound Name | (5R)-1-aza-4-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-12-amine |
|---|---|
| PubChem CID | 6934280 |
| Molecular Formula | C14H18N3+ |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | (5R)-1-aza-4-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-12-amine |
| SMILES | Nc1ccc2c(c1)c1c3n2CC[NH2+][C@@H]3CCC1 |
| InChI | InChI=1S/C14H17N3/c15-9-4-5-13-11(8-9)10-2-1-3-12-14(10)17(13)7-6-16-12/h4-5,8,12,16H,1-3,6-7,15H2/p+1/t12-/m1/s1 |
| InChIKey | XOXPHQFWWTZFNT-GFCCVEGCSA-O |
| XLogP | 1.18 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|