C12H17BO2 — CID 69343381
2-(5,5,6,6-tetramethylcyclohexa-1,3-dien-1-yl)-1,3,2-dioxaborole (PubChem CID 69343381) has the molecular formula C12H17BO2 and a molecular weight of 204.08 g/mol. Its IUPAC name is 2-(5,5,6,6-tetramethylcyclohexa-1,3-dien-1-yl)-1,3,2-dioxaborole.
| Compound Name | 2-(5,5,6,6-tetramethylcyclohexa-1,3-dien-1-yl)-1,3,2-dioxaborole |
|---|---|
| PubChem CID | 69343381 |
| Molecular Formula | C12H17BO2 |
| Molecular Weight | 204.08 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 2-(5,5,6,6-tetramethylcyclohexa-1,3-dien-1-yl)-1,3,2-dioxaborole |
| SMILES | CC1(C)C=CC=C(B2OC=CO2)C1(C)C |
| InChI | InChI=1S/C12H17BO2/c1-11(2)7-5-6-10(12(11,3)4)13-14-8-9-15-13/h5-9H,1-4H3 |
| InChIKey | ZJAXEIGOIBYTPQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.08 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|