About 5-chloro-7H-indole
5-chloro-7H-indole (PubChem CID 69343385) has the molecular formula C8H6ClN
and a molecular weight of 151.60 g/mol. Its IUPAC name is 5-chloro-7H-indole.
Molecular Properties
| Compound Name | 5-chloro-7H-indole |
| PubChem CID | 69343385 |
| Molecular Formula | C8H6ClN |
| Molecular Weight | 151.60 g/mol |
| Exact Mass | 151.02 |
| IUPAC Name | 5-chloro-7H-indole |
| SMILES | ClC1=CCC2=NC=CC2=C1 |
| InChI | InChI=1S/C8H6ClN/c9-7-1-2-8-6(5-7)3-4-10-8/h1,3-5H,2H2 |
| InChIKey | YKPNXEOHSAUELI-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.60 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-chloro-7H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-7H-indole?
The IUPAC name of 5-chloro-7H-indole (CID 69343385) is 5-chloro-7H-indole.
What is the SMILES notation for 5-chloro-7H-indole?
The canonical SMILES for 5-chloro-7H-indole is ClC1=CCC2=NC=CC2=C1.
What is the InChIKey of 5-chloro-7H-indole?
The InChIKey is YKPNXEOHSAUELI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClN/c9-7-1-2-8-6(5-7)3-4-10-8/h1,3-5H,2H2.
What are the key properties of 5-chloro-7H-indole?
5-chloro-7H-indole has a molecular weight of 151.60 g/mol, XLogP of 2.41, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-7H-indole is sourced from PubChem (CID 69343385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).