About CID 69343431
CID 69343431 (PubChem CID 69343431) has the molecular formula C6H4F3KNO
and a molecular weight of 202.20 g/mol.
Molecular Properties
| Compound Name | CID 69343431 |
| PubChem CID | 69343431 |
| Molecular Formula | C6H4F3KNO |
| Molecular Weight | 202.20 g/mol |
| Exact Mass | 201.99 |
| IUPAC Name | — |
| SMILES | O=c1cccc(C(F)(F)F)[nH]1.[K] |
| InChI | InChI=1S/C6H4F3NO.K/c7-6(8,9)4-2-1-3-5(11)10-4;/h1-3H,(H,10,11); |
| InChIKey | YAYYMNSZCASTRK-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.20 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 69343431 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 69343431?
The IUPAC name of CID 69343431 (CID 69343431) is not available.
What is the SMILES notation for CID 69343431?
The canonical SMILES for CID 69343431 is O=c1cccc(C(F)(F)F)[nH]1.[K].
What is the InChIKey of CID 69343431?
The InChIKey is YAYYMNSZCASTRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F3NO.K/c7-6(8,9)4-2-1-3-5(11)10-4;/h1-3H,(H,10,11);.
What are the key properties of CID 69343431?
CID 69343431 has a molecular weight of 202.20 g/mol, XLogP of 1.01, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 69343431 is sourced from PubChem (CID 69343431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).