C20H24N2O2 — CID 6934414
(4aS,10aS)-6,6-dimethyl-2-phenyl-3,4a,5,7,8,9,10,10a-octahydrobenzo[g]phthalazine-1,4-dione (PubChem CID 6934414) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is (4aS,10aS)-6,6-dimethyl-2-phenyl-3,4a,5,7,8,9,10,10a-octahydrobenzo[g]phthalazine-1,4-dione.
| Compound Name | (4aS,10aS)-6,6-dimethyl-2-phenyl-3,4a,5,7,8,9,10,10a-octahydrobenzo[g]phthalazine-1,4-dione |
|---|---|
| PubChem CID | 6934414 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | (4aS,10aS)-6,6-dimethyl-2-phenyl-3,4a,5,7,8,9,10,10a-octahydrobenzo[g]phthalazine-1,4-dione |
| SMILES | CC1(C)CCCC2=C1C[C@@H]1C(=O)NN(c3ccccc3)C(=O)[C@H]1C2 |
| InChI | InChI=1S/C20H24N2O2/c1-20(2)10-6-7-13-11-16-15(12-17(13)20)18(23)21-22(19(16)24)14-8-4-3-5-9-14/h3-5,8-9,15-16H,6-7,10-12H2,1-2H3,(H,21,23)/t15-,16-/m0/s1 |
| InChIKey | SEEZGBPPAWHPMP-HOTGVXAUSA-N |
| XLogP | 3.60 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|