C9H14N2O5 — CID 69344214
5-methyl-1-(2,2,3-trihydroxybutyl)pyrimidine-2,4-dione (PubChem CID 69344214) has the molecular formula C9H14N2O5 and a molecular weight of 230.22 g/mol. Its IUPAC name is 5-methyl-1-(2,2,3-trihydroxybutyl)pyrimidine-2,4-dione.
| Compound Name | 5-methyl-1-(2,2,3-trihydroxybutyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 69344214 |
| Molecular Formula | C9H14N2O5 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 5-methyl-1-(2,2,3-trihydroxybutyl)pyrimidine-2,4-dione |
| SMILES | Cc1cn(CC(O)(O)C(C)O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H14N2O5/c1-5-3-11(8(14)10-7(5)13)4-9(15,16)6(2)12/h3,6,12,15-16H,4H2,1-2H3,(H,10,13,14) |
| InChIKey | OUXMGHJUSALLHP-UHFFFAOYSA-N |
| XLogP | -2.09 |
| TPSA | 115.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|