About N-[(1R,2R)-2-aminocyclohexyl]methanesulfonamide
N-[(1R,2R)-2-aminocyclohexyl]methanesulfonamide (PubChem CID 69344413) has the molecular formula C7H16N2O2S
and a molecular weight of 192.28 g/mol. Its IUPAC name is N-[(1R,2R)-2-aminocyclohexyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[(1R,2R)-2-aminocyclohexyl]methanesulfonamide |
| PubChem CID | 69344413 |
| Molecular Formula | C7H16N2O2S |
| Molecular Weight | 192.28 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | N-[(1R,2R)-2-aminocyclohexyl]methanesulfonamide |
| SMILES | CS(=O)(=O)N[C@@H]1CCCC[C@H]1N |
| InChI | InChI=1S/C7H16N2O2S/c1-12(10,11)9-7-5-3-2-4-6(7)8/h6-7,9H,2-5,8H2,1H3/t6-,7-/m1/s1 |
| InChIKey | QSISIEZCYJFVIK-RNFRBKRXSA-N |
| XLogP | -0.19 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.28 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(1R,2R)-2-aminocyclohexyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R,2R)-2-aminocyclohexyl]methanesulfonamide?
The IUPAC name of N-[(1R,2R)-2-aminocyclohexyl]methanesulfonamide (CID 69344413) is N-[(1R,2R)-2-aminocyclohexyl]methanesulfonamide.
What is the SMILES notation for N-[(1R,2R)-2-aminocyclohexyl]methanesulfonamide?
The canonical SMILES for N-[(1R,2R)-2-aminocyclohexyl]methanesulfonamide is CS(=O)(=O)N[C@@H]1CCCC[C@H]1N.
What is the InChIKey of N-[(1R,2R)-2-aminocyclohexyl]methanesulfonamide?
The InChIKey is QSISIEZCYJFVIK-RNFRBKRXSA-N. The full InChI is InChI=1S/C7H16N2O2S/c1-12(10,11)9-7-5-3-2-4-6(7)8/h6-7,9H,2-5,8H2,1H3/t6-,7-/m1/s1.
What are the key properties of N-[(1R,2R)-2-aminocyclohexyl]methanesulfonamide?
N-[(1R,2R)-2-aminocyclohexyl]methanesulfonamide has a molecular weight of 192.28 g/mol, XLogP of -0.19, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R,2R)-2-aminocyclohexyl]methanesulfonamide is sourced from PubChem (CID 69344413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).