C17H19N3S — CID 6934443
5-[(1R)-1,2-diphenylethyl]-1,3,5-triazinane-2-thione (PubChem CID 6934443) has the molecular formula C17H19N3S and a molecular weight of 297.43 g/mol. Its IUPAC name is 5-[(1R)-1,2-diphenylethyl]-1,3,5-triazinane-2-thione.
| Compound Name | 5-[(1R)-1,2-diphenylethyl]-1,3,5-triazinane-2-thione |
|---|---|
| PubChem CID | 6934443 |
| Molecular Formula | C17H19N3S |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 5-[(1R)-1,2-diphenylethyl]-1,3,5-triazinane-2-thione |
| SMILES | S=C1NCN([C@H](Cc2ccccc2)c2ccccc2)CN1 |
| InChI | InChI=1S/C17H19N3S/c21-17-18-12-20(13-19-17)16(15-9-5-2-6-10-15)11-14-7-3-1-4-8-14/h1-10,16H,11-13H2,(H2,18,19,21)/t16-/m1/s1 |
| InChIKey | VHTUUHBKUWRLHR-MRXNPFEDSA-N |
| XLogP | 2.67 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|