About sodium;naphthalene;acetate
sodium;naphthalene;acetate (PubChem CID 69344549) has the molecular formula C12H11NaO2
and a molecular weight of 210.21 g/mol. Its IUPAC name is sodium;naphthalene;acetate.
Molecular Properties
| Compound Name | sodium;naphthalene;acetate |
| PubChem CID | 69344549 |
| Molecular Formula | C12H11NaO2 |
| Molecular Weight | 210.21 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | sodium;naphthalene;acetate |
| SMILES | CC(=O)[O-].[Na+].c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.C2H4O2.Na/c1-2-6-10-8-4-3-7-9(10)5-1;1-2(3)4;/h1-8H;1H3,(H,3,4);/q;;+1/p-1 |
| InChIKey | WTNXXLGBAMZWRP-UHFFFAOYSA-M |
| XLogP | -1.40 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.21 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sodium;naphthalene;acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;naphthalene;acetate?
The IUPAC name of sodium;naphthalene;acetate (CID 69344549) is sodium;naphthalene;acetate.
What is the SMILES notation for sodium;naphthalene;acetate?
The canonical SMILES for sodium;naphthalene;acetate is CC(=O)[O-].[Na+].c1ccc2ccccc2c1.
What is the InChIKey of sodium;naphthalene;acetate?
The InChIKey is WTNXXLGBAMZWRP-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H8.C2H4O2.Na/c1-2-6-10-8-4-3-7-9(10)5-1;1-2(3)4;/h1-8H;1H3,(H,3,4);/q;;+1/p-1.
What are the key properties of sodium;naphthalene;acetate?
sodium;naphthalene;acetate has a molecular weight of 210.21 g/mol, XLogP of -1.40, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;naphthalene;acetate is sourced from PubChem (CID 69344549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).